CAS 14548-47-1

(4-Methoxyphenyl)-4-pyridinylmethanone

Description:

(4-Methoxyphenyl)-4-pyridinylmethanone, also known by its CAS number 14548-47-1, is an organic compound characterized by its structure, which includes a methoxy group attached to a phenyl ring and a pyridine ring connected through a carbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl functional group. It may display moderate solubility in organic solvents, influenced by the methoxy group, which can enhance its lipophilicity. The presence of the pyridine ring suggests potential for coordination with metal ions, making it of interest in coordination chemistry. Additionally, compounds of this type may exhibit biological activity, which could be explored in pharmaceutical applications. Overall, (4-Methoxyphenyl)-4-pyridinylmethanone represents a versatile structure with potential implications in various fields, including medicinal chemistry and materials science.

Formula: C₁₃H₁₁NO₂

InChI: InChI=1S/C13H11NO2/c1-16-12-4-2-10(3-5-12)13(15)11-6-8-14-9-7-11/h2-9H,1H3

InChI key: InChIKey=FGEUIMWNIGSQPB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC)C=C1)C=2C=CN=CC2

Synonyms:

• (4-Methoxyphenyl)-4-pyridinylmethanone
• Ketone, p-methoxyphenyl 4-pyridyl
• Methanone, (4-Methoxyphenyl)-4-Pyridinyl-
• (4-Methoxyphenyl)(pyridin-4-yl)methanone

(4-Methoxyphenyl)(4-pyridyl) ketone

CAS: 14548-47-1

Formula: C₁₃H₁₁NO₂

Purity: 95%

Molecular weight: 213.2319

Ref: IN-DA00B4L6

METHANONE, (4-METHOXYPHENYL)-4-PYRIDINYL-

CAS: 14548-47-1

Formula: C₁₃H₁₁NO₂

Purity: ≥95%

Molecular weight: 213.236

Ref: 10-F534861

(4-Methoxyphenyl)(4-pyridyl)methanone

CAS: 14548-47-1

Oximes are compounds that react with hydroperoxides to form alcohols. They are classified as either primary or secondary, depending on the type of the nitrogen atom in the oxime. 4-Methoxyphenyl (4-pyridyl)methanone is a secondary oxime and reacts with peroxides to form an alkoxide. This reaction is reversible and can be used to measure peroxide concentration. The structure of 4-methoxyphenyl (4-pyridyl)methanone is pyridine with an intramolecular hydrogen bond and a quaternary carbon. Its spectra are characterized by a strong hydrogen bond between the hydroxymethyl group and the amide carbonyl group, which corresponds to nmr peaks at δ 2.24 ppm, δ 2.27 ppm, δ 3.42 ppm, δ 4.47 ppm, δ 5.80 ppm, and

Formula: C₁₃H₁₁NO₂

Purity: Min. 95%

Molecular weight: 213.23 g/mol

Ref: 3D-PAA54847