CymitQuimica logo

CAS 14548-50-6

:

7-CHLORO-3,4-DIHYDRO-1H-QUINOLIN-2-ONE

Description:
7-Chloro-3,4-dihydro-1H-quinolin-2-one, with the CAS number 14548-50-6, is a heterocyclic organic compound characterized by its quinoline structure, which features a fused ring system containing nitrogen. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure includes a chlorine atom at the 7-position and a carbonyl group at the 2-position, contributing to its reactivity and potential biological activity. The dihydro form indicates the presence of two hydrogen atoms that saturate the ring, which can influence its chemical properties and interactions. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, including antimicrobial and anti-inflammatory activities. Additionally, its derivatives may be explored for various therapeutic uses, making it a subject of research in drug development. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H8ClNO
InChI:InChI=1S/C9H8ClNO/c10-7-3-1-6-2-4-9(12)11-8(6)5-7/h1,3,5H,2,4H2,(H,11,12)
InChI key:HBKUREOLTIMYPY-UHFFFAOYSA-N
SMILES:C1CC(=O)NC2=C1C=CC(=C2)Cl
Found 5 products.