CymitQuimica logo

CAS 1454928-36-9

:

Methyl 2-(2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetate

Description:
Methyl 2-(2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetate is an organic compound characterized by its complex structure, which includes an ester functional group and a boron-containing moiety. The presence of the ethoxy group contributes to its solubility in organic solvents, while the dioxaborolane ring enhances its reactivity, particularly in cross-coupling reactions, making it useful in synthetic organic chemistry. The compound's molecular framework suggests potential applications in medicinal chemistry and materials science, particularly in the development of boron-containing pharmaceuticals or as intermediates in organic synthesis. Its stability and reactivity can be influenced by factors such as temperature and the presence of other reagents. Additionally, the compound's unique structural features may impart specific optical or electronic properties, which could be explored in various applications, including organic electronics or photonic devices. As with any chemical substance, proper handling and safety measures should be observed due to potential hazards associated with its components.
Formula:C17H25BO5
InChI:InChI=1S/C17H25BO5/c1-7-21-14-9-8-13(10-12(14)11-15(19)20-6)18-22-16(2,3)17(4,5)23-18/h8-10H,7,11H2,1-6H3
InChI key:XVSLTKBESTUKCZ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCC)CC(=O)OC
Found 3 products.