CAS 145508-94-7
:1-Boc-4-iodomethyl-piperidine
Description:
1-Boc-4-iodomethyl-piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The "Boc" (tert-butoxycarbonyl) group serves as a protecting group for the amine, enhancing the compound's stability and reactivity in various chemical reactions. The presence of the iodine atom at the 4-position of the piperidine ring introduces a halogen, which can participate in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. This compound is typically used in the synthesis of more complex molecules, particularly in medicinal chemistry and drug development. Its structure allows for various functionalization possibilities, and the Boc group can be removed under acidic conditions to yield the free amine. The compound is generally handled with care due to the presence of iodine, which can pose health risks. Overall, 1-Boc-4-iodomethyl-piperidine is a versatile building block in organic synthesis, particularly in the development of pharmaceuticals.
Formula:C11H20INO2
InChI:InChI=1/C11H20INO2/c1-11(2,3)15-10(14)13-6-4-9(8-12)5-7-13/h9H,4-8H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)CI
Synonyms:- 1-Tert-butoxycarbonyl-4-(iodomethyl)piperidine
- Tert-Butyl 4-(Iodomethyl)Piperidine-1-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Piperidinecarboxylic acid, 4-(iodomethyl)-, 1,1-dimethylethyl ester
CAS:Formula:C11H20INO2Purity:98%Color and Shape:SolidMolecular weight:325.1865Ref: IN-DA001D51
500gTo inquire250mg20.00€100mg21.00€1g27.00€5g40.00€10g56.00€25g101.00€50g153.00€100g205.00€250g635.00€tert-Butyl 4-(iodomethyl)piperidine-1-carboxylate
CAS:tert-Butyl 4-(iodomethyl)piperidine-1-carboxylateFormula:C11H20INO2Purity:98%Color and Shape:Solid-PowderMolecular weight:325.18646tert-Butyl 4-(Iodomethyl)piperidine-1-carboxylate
CAS:Formula:C11H20INO2Purity:97%Color and Shape:Solid, Low Melting SolidMolecular weight:325.191-Boc-4-Iodomethyl-Piperidine
CAS:Please enquire for more information about 1-Boc-4-Iodomethyl-Piperidine including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C11H20INO2Color and Shape:PowderMolecular weight:325.19 g/mol



