CAS 145511-50-8

(3aR)-8-methyl-2,3,3a,4,5,6-hexahydro-1H-pyrazino[3,2,1-jk]carbazole hydrochloride

Description:

(3aR)-8-methyl-2,3,3a,4,5,6-hexahydro-1H-pyrazino[3,2,1-jk]carbazole hydrochloride is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazino and carbazole moiety. This compound typically exhibits properties associated with its nitrogen-containing heterocycles, such as potential biological activity and solubility in polar solvents. The presence of the hydrochloride salt form suggests enhanced stability and solubility in aqueous environments, making it suitable for pharmaceutical applications. The specific stereochemistry indicated by the (3aR) designation implies a particular spatial arrangement of atoms, which can influence the compound's reactivity and interaction with biological targets. As a member of the carbazole family, it may exhibit fluorescence and other electronic properties, which could be relevant in various applications, including medicinal chemistry and materials science. Overall, this compound's unique structural features and properties make it of interest in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₅H₁₉ClN₂

InChI: InChI=1/C15H18N2.ClH/c1-10-5-6-14-12(9-10)11-3-2-4-13-15(11)17(14)8-7-16-13;/h5-6,9,13,16H,2-4,7-8H2,1H3;1H/t13-;/m1./s1

SMILES: Cc1ccc2c(c1)c1CCC[C@@H]3c1n2CCN3.Cl

(R)-Pirlindole HCl

CAS: 145511-50-8

Formula: C₁₅H₁₈N₂·HCl

Color and Shape: White To Off-White Solid

Molecular weight: 226.32 36.46

Ref: 4Z-P-270003

(R)-Pirlindole

CAS: 145511-50-8

Formula: C₁₅H₁₈N₂HCl

Molecular weight: 226.32 : 36.46

Ref: ST-EA-CP-P318003