CAS 145511-51-9

(3aS)-8-methyl-2,3,3a,4,5,6-hexahydro-1H-pyrazino[3,2,1-jk]carbazole hydrochloride

Description:

(3aS)-8-methyl-2,3,3a,4,5,6-hexahydro-1H-pyrazino[3,2,1-jk]carbazole hydrochloride is a chemical compound characterized by its complex polycyclic structure, which includes a pyrazino and carbazole moiety. This compound typically exhibits properties associated with its nitrogen-containing heterocycles, such as potential biological activity, including effects on the central nervous system or other pharmacological properties. The presence of the hydrochloride salt form suggests enhanced solubility in water, which is often advantageous for pharmaceutical applications. The stereochemistry indicated by the (3aS) designation implies a specific three-dimensional arrangement of atoms, which can significantly influence the compound's biological interactions and efficacy. As with many compounds in medicinal chemistry, its safety profile, including toxicity and side effects, would need to be thoroughly evaluated through preclinical and clinical studies. Overall, this compound represents a class of substances that may have therapeutic potential, warranting further investigation into its pharmacodynamics and pharmacokinetics.

Formula: C₁₅H₁₉ClN₂

InChI: InChI=1/C15H18N2.ClH/c1-10-5-6-14-12(9-10)11-3-2-4-13-15(11)17(14)8-7-16-13;/h5-6,9,13,16H,2-4,7-8H2,1H3;1H/t13-;/m0./s1

(S)-Pirlindole HCl

CAS: 145511-51-9

Formula: C₁₅H₁₈N₂·HCl

Color and Shape: White To Off-White Solid

Molecular weight: 226.32 36.46

Ref: 4Z-P-270004

(S)-Pirlindole

CAS: 145511-51-9

Formula: C₁₅H₁₈N₂HCl

Molecular weight: 226.32 : 36.46

Ref: ST-EA-CP-P318002