CAS 145513-92-4
:(2R,3aS,7aR)-Octahydro-1H-indole-2-carboxylic acid
Description:
(2R,3aS,7aR)-Octahydro-1H-indole-2-carboxylic acid is a bicyclic compound characterized by its unique structure, which includes a saturated indole framework. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The stereochemistry indicated by the (2R,3aS,7aR) notation suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions with other molecules. Typically, compounds like this may exhibit properties such as solubility in polar solvents, and they may participate in hydrogen bonding due to the presence of the carboxylic acid group. This substance is of interest in various fields, including medicinal chemistry and organic synthesis, where it may serve as a building block for more complex molecules or as a potential pharmacophore in drug development. Its specific characteristics, including melting point, boiling point, and reactivity, would depend on the conditions under which it is studied or utilized.
Formula:C9H15NO2
InChI:InChI=1S/C9H15NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h6-8,10H,1-5H2,(H,11,12)/t6-,7+,8+/m0/s1
InChI key:InChIKey=CQYBNXGHMBNGCG-XLPZGREQSA-N
SMILES:C(O)(=O)[C@H]1C[C@]2([C@](N1)(CCCC2)[H])[H]
Synonyms:- 1H-Indole-2-carboxylic acid, octahydro-, [2R-(2α,3aα,7aβ)]-
- 1H-Indole-2-carboxylic acid, octahydro-, (2R,3aS,7aR)-
- (2R,3aS,7aR)-Octahydro-1H-indole-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Perindopril Impurity 52 HCl
CAS:Formula:C9H15NO2·HClColor and Shape:White To Off-White SolidMolecular weight:169.22 36.46(2R,3aS,7aR)-Octahydro-1H-indole-2-carboxylic Acid
CAS:Controlled ProductFormula:C9H15NO2Color and Shape:NeatMolecular weight:169.22(2R,3aS,7aR)-Octahydro-1H-indole-2-carboxylic acid
CAS:(2R,3aS,7aR)-Octahydro-1H-indole-2-carboxylic acid is a drug product that is an analytical standard used in the study of metabolism. It is a natural compound that can be synthesized and purified. This chemical has been used as an impurity standard to identify other compounds. It has been used in the synthesis of other drugs and can be custom synthesized for research and development purposes. (2R,3aS,7aR)-Octahydro-1H-indole-2-carboxylic acid can be used as an HPLC standard or high purity chemical. This compound has shown pharmacopoeia activity and is used in drug development and research studies.Formula:C9H15NO2Purity:Min. 95%Molecular weight:169.22 g/mol



