CAS 145549-11-7
:(R)-1-BOC-3-PHENYL-PYRROLIDINE
Description:
(R)-1-BOC-3-phenyl-pyrrolidine is a chiral compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The "BOC" (tert-butyloxycarbonyl) group serves as a protective group for the amine, enhancing the compound's stability and facilitating its use in various synthetic applications. The presence of the phenyl group at the 3-position of the pyrrolidine ring contributes to its aromatic character and can influence its reactivity and interaction with biological systems. This compound is often utilized in organic synthesis, particularly in the development of pharmaceuticals, due to its potential as a building block for more complex molecules. Its chirality is significant in medicinal chemistry, as the (R)-enantiomer may exhibit different biological activity compared to its (S)-counterpart. The compound's properties, such as solubility and melting point, can vary based on the specific conditions and solvents used in its handling and application. Overall, (R)-1-BOC-3-phenyl-pyrrolidine is a valuable intermediate in the synthesis of various chemical entities.
Formula:C15H21NO2
InChI:InChI=1/C15H21NO2/c1-15(2,3)18-14(17)16-10-9-13(11-16)12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3/t13-/m0/s1
SMILES:CC(C)(C)OC(=O)N1CC[C@@H](C1)c1ccccc1
Synonyms:- (R)-3-Phenyl-pyrrolidine-1-carboxylic acid tert-butyl ester
- tert-butyl (3R)-3-phenylpyrrolidine-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
