CAS 145586-17-0
:H-D-LYS(Z)-OME HCL
Description:
H-D-LYS(Z)-OME HCl, also known as Z-Lysine methyl ester hydrochloride, is a derivative of the amino acid lysine, characterized by the presence of a Z-protecting group on the amino group and a methyl ester at the carboxylic acid end. This compound is typically utilized in peptide synthesis and research due to its ability to protect the amino group during chemical reactions, allowing for selective modifications. The hydrochloride salt form enhances its solubility in aqueous solutions, making it suitable for various biochemical applications. As a lysine derivative, it retains the basic properties of lysine, including its positive charge at physiological pH, which can influence its interactions in biological systems. The Z-protecting group can be removed under specific conditions, facilitating the synthesis of peptides with precise sequences. Overall, H-D-LYS(Z)-OME HCl is a valuable intermediate in organic synthesis and peptide chemistry, contributing to the development of pharmaceuticals and biochemicals.
Formula:C15H23ClN2O4
InChI:InChI=1/C15H22N2O4.ClH/c1-20-14(18)13(16)9-5-6-10-17-15(19)21-11-12-7-3-2-4-8-12;/h2-4,7-8,13H,5-6,9-11,16H2,1H3,(H,17,19);1H/t13-;/m0./s1
SMILES:COC(=O)[C@H](CCCCN=C(O)OCc1ccccc1)N.Cl
Synonyms:- D-Lysine(Z)-Ome Hcl
- N-Epsilon-Z-D-Lysine Methyl Ester Hydrochloride
- N-Epsilon-Benzyloxycarbonyl-D-Lysine Methyl Ester Hydrochloride Salt
- N-Epsilon-Carbobenzoxy-D-Lysine Methyl Ester Hydrochloride
- NEPSILON-Benzyloxycarbonyl-D-lysine methyl ester hydrochloride
- methyl N6-[(benzyloxy)carbonyl]-L-lysinate hydrochloride
- H-D-Lys(Z)-OMe・HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
