CAS 145591-80-6
:Cyclopropanecarboxylic acid, 1-[(phenylamino)carbonyl]-
Description:
Cyclopropanecarboxylic acid, 1-[(phenylamino)carbonyl]- is an organic compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring known for its unique strain and reactivity. This compound features a carboxylic acid functional group, which imparts acidic properties and enhances its reactivity in various chemical reactions. The presence of the phenylamino group indicates that it has an amine functionality attached to a phenyl ring, contributing to its potential as a building block in organic synthesis and medicinal chemistry. The compound's structure suggests it may exhibit interesting biological activities, making it a candidate for further research in pharmaceutical applications. Additionally, its molecular interactions could be influenced by the steric and electronic effects of the cyclopropane and phenyl groups. Overall, this compound's unique structural features and functional groups make it a subject of interest in both synthetic and applied chemistry.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c13-9(11(6-7-11)10(14)15)12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13)(H,14,15)
InChI key:KDXROTVXLGAFGW-UHFFFAOYSA-N
SMILES:C1CC1(C(=O)NC2=CC=CC=C2)C(=O)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-(Phenylcarbamoyl)cyclopropanecarboxylic acid
CAS:1-(Phenylcarbamoyl)cyclopropanecarboxylic acidFormula:C11H11NO3Purity:95%Molecular weight:205.21Cyclopropanecarboxylic acid, 1-[(phenylamino)carbonyl]-
CAS:Formula:C11H11NO3Purity:95%Color and Shape:SolidMolecular weight:205.20991-(Phenylcarbamoyl)cyclopropanecarboxylic acid
CAS:1-(Phenylcarbamoyl)cyclopropanecarboxylic acidFormula:C11H11NO3Purity:95%Molecular weight:205.211-(Phenylcarbamoyl)cyclopropanecarboxylic acid, Cabozantinib Impurity
CAS:Purity:98%Molecular weight:205.071-(Phenylcarbamoyl)cyclopropanecarboxylic acid
CAS:Formula:C11H11NO3Purity:95%Molecular weight:205.2131-(Phenylcarbamoyl)cyclopropanecarboxylic acid
CAS:1-(Phenylcarbamoyl)cyclopropanecarboxylic acid is a molecule that has been shown to have antitumor activity. It has been shown to inhibit the growth of cancer cells in a number of in vitro and in vivo studies. The crystal structure of 1-phenylcarbamoyl-cyclopropanecarboxylic acid was determined using single-crystal x-ray analysis, and it was found that this molecule exhibits an optimized electrostatic surface potential. This molecule also exhibits strong hydrogen bonding interactions with morpholine molecules, which may contribute to its anti-cancer properties. 1-(Phenylcarbamoyl)cyclopropanecarboxylic acid interacts with DNA by binding to the minor groove on the outside of the helix and disrupting DNA replication or transcription.Formula:C11H11NO3Purity:Min. 95%Molecular weight:205.21 g/mol







