CymitQuimica logo

CAS 145591-80-6

:

Cyclopropanecarboxylic acid, 1-[(phenylamino)carbonyl]-

Description:
Cyclopropanecarboxylic acid, 1-[(phenylamino)carbonyl]- is an organic compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring known for its unique strain and reactivity. This compound features a carboxylic acid functional group, which imparts acidic properties and enhances its reactivity in various chemical reactions. The presence of the phenylamino group indicates that it has an amine functionality attached to a phenyl ring, contributing to its potential as a building block in organic synthesis and medicinal chemistry. The compound's structure suggests it may exhibit interesting biological activities, making it a candidate for further research in pharmaceutical applications. Additionally, its molecular interactions could be influenced by the steric and electronic effects of the cyclopropane and phenyl groups. Overall, this compound's unique structural features and functional groups make it a subject of interest in both synthetic and applied chemistry.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c13-9(11(6-7-11)10(14)15)12-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13)(H,14,15)
InChI key:KDXROTVXLGAFGW-UHFFFAOYSA-N
SMILES:C1CC1(C(=O)NC2=CC=CC=C2)C(=O)O
Found 9 products.