CymitQuimica logo

CAS 1456-19-5

:

2-(2-phenylethenyl)-1H-benzimidazole

Description:
2-(2-Phenylethenyl)-1H-benzimidazole, with the CAS number 1456-19-5, is an organic compound characterized by its unique structure that combines a benzimidazole moiety with a phenylethenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential for various chemical reactions. It is generally insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. The presence of the benzimidazole ring contributes to its biological activity, making it of interest in medicinal chemistry, particularly for its potential pharmacological properties. Additionally, the phenylethenyl group can influence its electronic properties and reactivity, which may be relevant in applications such as organic synthesis or materials science. Overall, 2-(2-phenylethenyl)-1H-benzimidazole is a compound of interest due to its structural features and potential applications in various fields of chemistry and biochemistry.
Formula:C15H12N2
InChI:InChI=1/C15H12N2/c1-2-6-12(7-3-1)10-11-15-16-13-8-4-5-9-14(13)17-15/h1-11H,(H,16,17)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.