CAS 1456-22-0
:5-Hydroxy-3-phenyl-1,2,4-oxadiazole
Description:
5-Hydroxy-3-phenyl-1,2,4-oxadiazole, with the CAS number 1456-22-0, is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a hydroxyl group (-OH) at the 5-position and a phenyl group at the 3-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activities and ability to participate in various chemical reactions. Its structure allows for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Additionally, the phenyl group can enhance its stability and affect its electronic properties, making it a subject of study in organic synthesis and medicinal chemistry.
Formula:C8H6N2O2
InChI:InChI=1/C8H6N2O2/c11-8-9-7(10-12-8)6-4-2-1-3-5-6/h1-5H,(H,9,10,11)
InChI key:InChIKey=LMBDRBXGTCUBIH-UHFFFAOYSA-N
SMILES:O=C1NC(=NO1)C2=CC=CC=C2
Synonyms:- 1,2,4-Oxadiazol-5(2H)-one, 3-phenyl-
- 1,2,4-Oxdiazol-5-ol, 3-phenyl-
- 3-Phenyl-1,2,4-oxadiazol-5-ol
- 3-Phenyl-2H-1,2,4-oxadiazol-5-one
- 3-Phenyl-4,5-dihydro-1,2,4-oxadiazol-5-one
- 3-Phenyl-5-hydroxy-1,2,4-oxadiazole
- 3-phenyl-1,2,4-oxadiazol-5(2H)-one
- 5-Hydroxy-3-phenyl-1,2,4-oxadiazole
- Δ<sup>2</sup>-1,2,4-Oxadiazolin-5-one, 3-phenyl-
- Δ2-1,2,4-Oxadiazolin-5-one, 3-phenyl-
- 3-Phenyl-4,5-dihydro-1,2,4-oxadiazole-5-one
- 3-phenyl-1,2,4-oxadiazol-5(4H)-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2,4-Oxadiazol-5(2H)-one, 3-phenyl-
CAS:Formula:C8H6N2O2Purity:97%Color and Shape:SolidMolecular weight:162.14543-Phenyl-[1,2,4]oxadiazol-5-ol
CAS:3-Phenyl-[1,2,4]oxadiazol-5-olPurity:95%Molecular weight:162.15g/mol3-Phenyl-[1,2,4]oxadiazol-5-ol
CAS:Formula:C8H6N2O2Purity:97%Color and Shape:SolidMolecular weight:162.1483-Phenyl-1,2,4-oxadiazol-5-ol
CAS:<p>3-Phenyl-1,2,4-oxadiazol-5-ol is a thione that has been shown to be conjugated with DNA and RNA. It is also able to form complexes with metal ions. This compound is spectroscopically active and can be used for the evaluation of biomolecules in vitro. 3-Phenyl-1,2,4-oxadiazol-5-ol can be used as an alternative to ethidium bromide for the detection of nucleic acids in agarose gel electrophoresis. It has been shown to inhibit protein synthesis in bacteria by binding to ribosomes and inhibiting protein synthesis.</p>Formula:C8H6N2O2Purity:Min. 95%Molecular weight:162.15 g/mol



