CAS 14561-40-1
:rel-(1R,2R)-2-Phenylcyclopropanecarboxylic acid hydrazide
Description:
Rel-(1R,2R)-2-Phenylcyclopropanecarboxylic acid hydrazide is a chemical compound characterized by its unique cyclopropane structure, which contributes to its rigidity and potential reactivity. This compound features a phenyl group attached to a cyclopropane ring, along with a carboxylic acid hydrazide functional group. The stereochemistry indicated by the "rel-(1R,2R)" notation suggests specific spatial arrangements of the substituents around the cyclopropane, which can influence its biological activity and interaction with other molecules. The presence of the hydrazide functional group may impart properties such as increased solubility in polar solvents and potential reactivity in condensation reactions. This compound is of interest in medicinal chemistry and organic synthesis, where its structural features may be leveraged for the development of pharmaceuticals or agrochemicals. Additionally, its CAS number, 14561-40-1, allows for easy identification and reference in chemical databases and literature. Overall, the compound's unique structure and functional groups make it a subject of interest in various chemical research fields.
Formula:C10H12N2O
InChI:InChI=1/C10H12N2O/c11-12-10(13)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6,11H2,(H,12,13)/t8-,9+/s2
InChI key:InChIKey=LVPLGMIOSVEITG-BRJQIKQINA-N
SMILES:C(NN)(=O)[C@H]1[C@@H](C1)C2=CC=CC=C2
Synonyms:- Cyclopropanecarboxylic acid, 2-phenyl-, hydrazide
- Cyclopropanecarboxylic acid, 2-phenyl-, hydrazide, (1R,2R)-rel-
- Cyclopropanecarboxylic acid, 2-phenyl-, hydrazide, trans-
- rel-(1R,2R)-2-Phenylcyclopropanecarboxylic acid hydrazide
- trans-2-Phenylcyclopropanecarboxylic hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Tranylcypromine sulfate impurity standard
CAS:Tranylcypromine sulfate impurity standardColor and Shape:White To Off-White



