
CAS 14561-55-8
:4-Methylglutamic acid
Description:
4-Methylglutamic acid, with the CAS number 14561-55-8, is an amino acid derivative that is structurally related to glutamic acid. It features a methyl group attached to the fourth carbon of the glutamic acid backbone, which influences its properties and biological activity. This compound is typically a white crystalline solid and is soluble in water, making it suitable for various biochemical applications. 4-Methylglutamic acid is known to play a role in metabolic pathways and can act as a neurotransmitter or a precursor in the synthesis of other biologically relevant molecules. Its presence in biological systems is significant, as it may contribute to cellular signaling and metabolic regulation. Additionally, it is often studied for its potential implications in neurobiology and its effects on brain function. As with many amino acids, it can exist in different ionic forms depending on the pH of the environment, which can affect its reactivity and interactions with other molecules.
Formula:C6H11NO4
InChI:InChI=1S/C6H11NO4/c1-3(5(8)9)2-4(7)6(10)11/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11)
InChI key:InChIKey=KRKRAOXTGDJWNI-UHFFFAOYSA-N
SMILES:C(CC(C(O)=O)N)(C(O)=O)C
Synonyms:- NSC 16564
- Glutamic acid, 4-methyl-
- γ-Methylglutamic acid
- 4-Methylglutamic acid
- SYM 2049
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
