CymitQuimica logo

CAS 145625-08-7

:

4-Methyl 2-Tert-Butyloxazolidine-3,4-Dicarboxylate

Description:
4-Methyl 2-Tert-Butyloxazolidine-3,4-Dicarboxylate is a chemical compound characterized by its oxazolidine ring structure, which incorporates both methyl and tert-butyl substituents. This compound features two carboxylate functional groups, contributing to its potential reactivity and solubility in various solvents. The presence of the tert-butyl group enhances steric hindrance, which can influence the compound's reactivity and interactions with other molecules. Typically, compounds of this nature are of interest in organic synthesis and medicinal chemistry due to their potential applications in drug development and as intermediates in the synthesis of more complex molecules. The specific stereochemistry and functional groups present in 4-Methyl 2-Tert-Butyloxazolidine-3,4-Dicarboxylate may also impart unique properties, such as varying degrees of polarity and solubility. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound exemplifies the complexity and diversity found within organic chemistry.
Formula:C14H25NO5
InChI:InChI=1S/C14H25NO5/c1-13(2,3)11-15(12(17)20-14(4,5)6)9(8-19-11)10(16)18-7/h9,11H,8H2,1-7H3/t9-,11+/m0/s1
InChI key:GZAZHWGEIRAXKK-GXSJLCMTSA-N
SMILES:CC(C)(C)[C@@H]1N([C@@H](CO1)C(=O)OC)C(=O)OC(C)(C)C
Found 3 products.