CymitQuimica logo

CAS 145626-93-3

:

BIS(2-MERCAPTOETHYL) SULFONE DISULFIDE

Description:
BIS(2-MERCAPTOETHYL) SULFONE DISULFIDE, with the CAS number 145626-93-3, is a chemical compound characterized by its unique structure that includes two mercaptoethyl groups and a sulfone disulfide linkage. This compound typically appears as a solid or viscous liquid and is known for its strong thiol functional groups, which contribute to its reactivity and ability to form disulfide bonds. It is often utilized in various applications, including polymer chemistry, where it can act as a crosslinking agent, enhancing the mechanical properties of materials. Additionally, its thiol groups can participate in redox reactions, making it valuable in biochemical applications. The compound is generally handled with care due to its potential reactivity and the presence of sulfur, which can impart specific odors. Safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure. Overall, BIS(2-MERCAPTOETHYL) SULFONE DISULFIDE is a versatile compound with significant utility in both industrial and research settings.
Formula:C4H8O2S3
InChI:InChI=1/C4H8O2S3/c5-9(6)3-1-7-8-2-4-9/h1-4H2
SMILES:C1CS(=O)(=O)CCSS1
Synonyms:
  • BMSDIsulfide,
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.