CymitQuimica logo

CAS 145689-33-4

:

6-AMINO-2,3-DIFLUOROBENZENEETHANOL

Description:
6-Amino-2,3-difluorobenzeneethanol is an organic compound characterized by the presence of an amino group and a hydroxyl group attached to a difluorobenzene ring. The structure features a benzene ring substituted with two fluorine atoms at the 2 and 3 positions, enhancing its reactivity and potential applications in various chemical reactions. The amino group contributes to its basicity and potential for forming hydrogen bonds, while the hydroxyl group increases its solubility in polar solvents. This compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its fluorinated nature can influence its pharmacokinetic properties, such as metabolic stability and lipophilicity. Additionally, the presence of both fluorine and hydroxyl groups can lead to unique interactions in biological systems. As with many fluorinated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact. Overall, 6-amino-2,3-difluorobenzeneethanol represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C8H9F2NO
InChI:InChI=1/C8H9F2NO/c9-6-1-2-7(11)5(3-4-12)8(6)10/h1-2,12H,3-4,11H2
InChI key:BRPOPHUWIWJPIY-UHFFFAOYSA-N
SMILES:c1cc(c(CCO)c(c1F)F)N
Synonyms:
  • 2-(6-Amino-2,3-difluorophenyl)ethanol
  • Benzeneethanol, 6-Amino-2,3-Difluoro-
  • 6-Amino-2,3-difluorobenzeneethanol
Found 1 products.