CAS 145691-59-4

3,5-Dibromobenzyl alcohol

Description:

3,5-Dibromobenzyl alcohol is an organic compound characterized by the presence of a benzyl alcohol structure with two bromine substituents located at the 3 and 5 positions on the aromatic ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic aromatic nature. The presence of bromine atoms enhances its reactivity, making it a useful intermediate in various organic synthesis reactions, including coupling reactions and as a building block for more complex molecules. Additionally, the hydroxyl group (-OH) in the benzyl alcohol moiety contributes to its potential as a hydrogen bond donor, influencing its interactions in chemical reactions and biological systems. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. As with many brominated compounds, it is important to handle 3,5-dibromobenzyl alcohol with care due to potential toxicity and environmental concerns associated with brominated organic compounds.

Formula: C₇H₆Br₂O

InChI: InChI=1/C7H6Br2O/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2

SMILES: c1c(cc(cc1Br)Br)CO

Synonyms:

• (3,5-Dibromophenyl)Methanol

Benzenemethanol, 3,5-dibromo-

CAS: 145691-59-4

Formula: C₇H₆Br₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 265.9299

Ref: IN-DA001DB1

3,5-Dibromobenzyl alcohol

CAS: 145691-59-4

3,5-Dibromobenzyl alcohol

Purity: 98%

Molecular weight: 265.93g/mol

Ref: 54-OR912688

3,5-Dibromobenzyl alcohol

CAS: 145691-59-4

Formula: C₇H₆Br₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 265.932

Ref: 10-F033769