CAS 1457-59-6
:5-methyl-1H-4-carboxylic acid
Description:
5-Methyl-1H-4-carboxylic acid, also known as 5-methyl-2-pyridinecarboxylic acid, is an organic compound characterized by its pyridine ring structure with a carboxylic acid functional group and a methyl substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid group. It exhibits acidic properties, allowing it to donate protons in solution, which is a key characteristic of carboxylic acids. The presence of the methyl group influences its reactivity and can affect its interactions with other molecules, making it of interest in various chemical syntheses and applications. Additionally, its structural features may contribute to its potential biological activity, although specific biological properties would require further investigation. As with many organic compounds, proper handling and storage are essential to ensure safety and stability.
Formula:C5H6N2O2
InChI:InChI=1S/C5H6N2O2/c1-3-4(5(8)9)7-2-6-3/h2H,1H3,(H,6,7)(H,8,9)
InChI key:InChIKey=ULHLTDXPKWELHQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)N=CN1
Synonyms:- 1H-Imidazole-4-carboxylic acid, 5-methyl-
- 1H-Imidazole-5-carboxylic acid, 4-methyl-
- 4-Methyl-5-imidazolecarboxylic acid
- 4-methyl-1H-imidazole-5-carboxylic acid
- 5-Methyl-1H-imidazole-4-carboxylic acid
- 5-Methyl-4-imidazolylcarboxylic acid
- 5-Methylimidazole-4-carboxylic acid
- Imidazole-4(or 5)-carboxylic acid, 5(or 4)-methyl-
- Imidazole-4-carboxylic acid, 5-methyl-
- 5-Methyl-1H-4-carboxylic acid
- 5-methyl-1H-imidazole-4-carboxylic acid(SALTDATA: FREE)
- EINECS 215-944-0
- 5-Methyl-4-imidazolecarboxylic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazole-5-carboxylic acid, 4-methyl-
CAS:Formula:C5H6N2O2Purity:98%Color and Shape:SolidMolecular weight:126.1133Ref: IN-DA001DBV
1g28.00€5g67.00€10g124.00€25g176.00€100g616.00€250gTo inquire500gTo inquire250mg26.00€4-Methyl-1H-imidazole-5-carboxylic acid
CAS:4-Methyl-1H-imidazole-5-carboxylic acidPurity:97%Molecular weight:126.11g/mol5-methyl-1H-imidazole-4-carboxylic acid
CAS:Formula:C5H6N2O2Purity:95%Color and Shape:SolidMolecular weight:126.1154-Methyl-1H-Imidazole-5-Carboxylic Acid Hydrate
CAS:Controlled ProductApplications 4-Methyl-1H-imidazole-5-carboxylic Acid is used in preparation of Cyclohexyl Benzamide compounds for treatment of type II diabetes. Also, used in preparation of Triazolylphenyl substituted Amides as apoptosis signal-regulating kinase inhibitors.
References Hu, Z., et al.: PCT Int. Appl.,(2018); Corkey, B., et al.: U.S., (2015);Formula:C5H6N2O2·xH2OColor and Shape:NeatMolecular weight:144.13



