CAS 145742-38-7
:2-(cyclopentyloxy)benzaldehyde
Description:
2-(Cyclopentyloxy)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde group substituted with a cyclopentyloxy moiety. This compound typically exhibits a pale yellow to light brown appearance and is known for its distinctive aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic cyclopentyl group. The presence of the aldehyde functional group makes it reactive, particularly in nucleophilic addition reactions, and it can participate in various chemical transformations, including oxidation and condensation reactions. This compound may be utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as an intermediate. Additionally, its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as with many organic chemicals, to mitigate risks associated with exposure and reactivity.
Formula:C12H14O2
InChI:InChI=1/C12H14O2/c13-9-10-5-1-4-8-12(10)14-11-6-2-3-7-11/h1,4-5,8-9,11H,2-3,6-7H2
SMILES:c1ccc(c(c1)C=O)OC1CCCC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Cyclopentyloxy)benzaldehyde
CAS:2-(Cyclopentyloxy)benzaldehydePurity:97%Molecular weight:190.24g/mol2-Cyclopentyloxy-benzaldehyde
CAS:2-Cyclopentyloxy-benzaldehyde has potent inhibitory activity against inflammatory diseases. It is a chemical compound that contains an amido group and two cyclopentyloxy groups. 2-Cyclopentyloxy-benzaldehyde inhibits the activation of glycogen synthase kinase-3, which is a protein that regulates inflammation in the body. This substance can be used to inhibit the spread of HIV or viral infections by inhibiting protein synthesis in these viruses. 2-Cyclopentyloxy-benzaldehyde also has an inhibitory effect on cachexia, which is a condition characterized by weight loss, muscle wasting, and fatigue.
Formula:C12H14O2Purity:Min. 95%Molecular weight:190.24 g/mol



