CymitQuimica logo

CAS 145742-68-3

:

Benzaldehyde, 5-chloro-2-(difluoromethoxy)-

Description:
Benzaldehyde, 5-chloro-2-(difluoromethoxy)-, with the CAS number 145742-68-3, is an organic compound characterized by its aromatic structure, which includes a benzene ring attached to a formyl group (–CHO) and a chloro substituent at the 5-position. The presence of a difluoromethoxy group (–O–CF2) at the 2-position contributes to its unique chemical properties, including increased polarity and potential reactivity. This compound is typically a colorless to pale yellow liquid with a distinctive almond-like odor, characteristic of benzaldehyde derivatives. It is soluble in organic solvents and may exhibit moderate solubility in water due to the polar difluoromethoxy group. The compound's reactivity can be influenced by the electron-withdrawing effects of the chloro and difluoromethoxy groups, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H5ClF2O2
InChI:InChI=1S/C8H5ClF2O2/c9-6-1-2-7(13-8(10)11)5(3-6)4-12/h1-4,8H
InChI key:FRNLODWJIKMPDY-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Cl)C=O)OC(F)F
Found 5 products.