CAS 145758-05-0
:3,4-Difluorobenzenesulphonyl chloride
Description:
3,4-Difluorobenzenesulphonyl chloride is an organic compound characterized by the presence of a sulphonyl chloride functional group attached to a benzene ring that has two fluorine substituents in the para positions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the sulphonyl chloride group, which can act as a potent electrophile in various chemical reactions, making it useful in the synthesis of sulphonamides and other derivatives. The presence of fluorine atoms enhances its electrophilic character and can influence its solubility and stability. 3,4-Difluorobenzenesulphonyl chloride is often handled with care due to its potential to release toxic gases upon hydrolysis and its corrosive nature. It is primarily utilized in organic synthesis and pharmaceutical applications, where it serves as an important intermediate in the preparation of various chemical compounds. Proper safety measures should be observed when working with this substance due to its hazardous properties.
Formula:C18H19F21O3Si
InChI:InChI=1/C18H19F21O3Si/c1-4-40-43(41-5-2,42-6-3)8-7-9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)15(31,32)16(33,34)17(35,36)18(37,38)39/h4-8H2,1-3H3
SMILES:CCO[Si](CCC(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(OCC)OCC
Synonyms:- 3,4-Difluorobenzene-1-sulfonyl chloride
- 3,4-Difluorobenzenesulfonyl Chloride
- (5S)-5-(hydroxymethyl)pyrrolidin-2-one
- Triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-Henicosafluorododecyl)Silane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Difluorobenzenesulfonyl chloride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H3ClF2O2SPurity:97%Color and Shape:Liquid, Clear yellowMolecular weight:212.59Benzenesulfonyl chloride, 3,4-difluoro-
CAS:Formula:C6H3ClF2O2SPurity:98%Color and Shape:LiquidMolecular weight:212.60163,4-Difluorobenzenesulphonyl chloride
CAS:3,4-Difluorobenzenesulphonyl chlorideFormula:C6H3ClF2O2SPurity:98%Color and Shape: clear. faint orange liquidMolecular weight:212.60g/mol3,4-Difluorobenzenesulfonyl Chloride
CAS:Formula:C6H3ClF2O2SPurity:>98.0%(GC)(T)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:212.593,4-Difluorobenzenesulfonyl chloride
CAS:Formula:C6H3ClF2O2SPurity:97%Color and Shape:Liquid, ClearMolecular weight:212.59




