CAS 145775-14-0
:N-[2-(2-methylbenzyl)-3-sulfanylpropanoyl]-L-methionine
Description:
N-[2-(2-methylbenzyl)-3-sulfanylpropanoyl]-L-methionine, with the CAS number 145775-14-0, is a synthetic compound that belongs to the class of amino acids, specifically a derivative of L-methionine. This compound features a unique structure characterized by the presence of a sulfanyl (thiol) group, which contributes to its reactivity and potential biological activity. The 2-methylbenzyl group attached to the propanoyl moiety enhances its lipophilicity, potentially influencing its interaction with biological membranes and proteins. The presence of the methionine backbone suggests that it may participate in various biochemical processes, including protein synthesis and methylation reactions. Additionally, the sulfanyl group may impart antioxidant properties, making it of interest in studies related to oxidative stress and cellular signaling. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation in medicinal chemistry and biochemistry contexts.
Formula:C16H23NO3S2
InChI:InChI=1/C16H23NO3S2/c1-11-5-3-4-6-12(11)9-13(10-21)15(18)17-14(16(19)20)7-8-22-2/h3-6,13-14,21H,7-10H2,1-2H3,(H,17,18)(H,19,20)/t13?,14-/m0/s1
SMILES:Cc1ccccc1CC(CS)C(=N[C@@H](CCSC)C(=O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2S)-2-(3-Mercapto-2-(2-methylbenzyl)propanamido)-4-(methylthio)butanoic acid
CAS:Formula:C16H23NO3S2Molecular weight:341.48872-[[2-[(2-Methylphenyl)methyl]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoic acid
CAS:<p>2-[[2-[(2-Methylphenyl)methyl]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoic acid is a specialized chemical compound often encountered in pharmaceutical and biochemical research contexts. It is typically synthesized through intricate organic chemistry pathways involving the incorporation of thiol and methylphenyl groups onto a butanoic acid backbone. This compound is a derivative of amino acids, making it relevant for studies related to peptide synthesis and enzymatic interactions.</p>Formula:C16H23NO3S2Purity:Min. 95%Molecular weight:341.5 g/molNEP-IN-2
CAS:<p>NEP-IN-2 is an inhibitor of neutral endopeptidase. It also is used in the research of proliferation in atherosclerosis, restenosis.</p>Formula:C16H23NO3S2Purity:98%Color and Shape:SolidMolecular weight:341.49


