CAS 145788-82-5: N-(4-{[(2,7-dimethyl-4-oxo-1,4-dihydroquinazolin-6-yl)methyl](prop-2-yn-1-yl)amino}-2-fluorobenzoyl)-L-gamma-glutamyl-D-glutamic acid
Description:N-(4-{[(2,7-dimethyl-4-oxo-1,4-dihydroquinazolin-6-yl)methyl](prop-2-yn-1-yl)amino}-2-fluorobenzoyl)-L-gamma-glutamyl-D-glutamic acid is a complex organic compound characterized by its unique structural features, including a quinazoline moiety, a fluorobenzoyl group, and amino acid components. The presence of the 2-fluorobenzoyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's structure indicates it may exhibit significant biological activity, possibly as an enzyme inhibitor or receptor modulator, due to the presence of multiple functional groups that can interact with biological targets. Additionally, the incorporation of amino acids like L-gamma-glutamyl and D-glutamic acid may enhance its solubility and bioavailability. The compound's molecular complexity and specific stereochemistry could also influence its pharmacokinetic properties, making it a candidate for further investigation in drug development. Overall, this substance represents a fascinating area of study within the field of medicinal chemistry and biochemistry.
Formula:C31H32FN5O9
InChI:InChI=1/C31H32FN5O9/c1-4-11-37(15-18-13-21-25(12-16(18)2)33-17(3)34-29(21)42)19-5-6-20(22(32)14-19)28(41)36-24(31(45)46)7-9-26(38)35-23(30(43)44)8-10-27(39)40/h1,5-6,12-14,23-24H,7-11,15H2,2-3H3,(H,35,38)(H,36,41)(H,39,40)(H,43,44)(H,45,46)(H,33,34,42)/t23-,24+/m1/s1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | CB 30900 REF: 3D-FC175594CAS: 145788-82-5 | Min. 95% | To inquire | Mon 24 Mar 25 |
![]() | CB 30900 REF: TM-T30760CAS: 145788-82-5 | - - - | 2,442.00 €~4,370.00 € | Thu 12 Jun 25 |

CB 30900
Ref: TM-T30760
25mg | 2,442.00 € | ||
50mg | 3,212.00 € | ||
100mg | 4,370.00 € |