CAS 145798-74-9

4-Isoxazolecarboxylicacid,5-amino-,methylester(9CI)

Description:

4-Isoxazolecarboxylic acid, 5-amino-, methyl ester, also known by its CAS number 145798-74-9, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a bioactive molecule. The methyl ester form indicates that the carboxylic acid is esterified with methanol, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit various biological activities, making them of interest in medicinal chemistry and drug development. The presence of the isoxazole moiety often correlates with specific pharmacological properties, including anti-inflammatory or antimicrobial effects. Additionally, the compound's stability, reactivity, and interaction with biological targets can be influenced by its functional groups and molecular structure, making it a subject of study in both synthetic and medicinal chemistry contexts.

Formula: C₅H₆N₂O₃

InChI: InChI=1/C5H6N2O3/c1-9-5(8)3-2-7-10-4(3)6/h2H,6H2,1H3

SMILES: COC(=O)c1cnoc1N

Synonyms:

• Methyl 5-Aminoisoxazole-4-Carboxylate

Methyl 5-aminoisoxazole-4-carboxylate

CAS: 145798-74-9

Formula: C₅H₆N₂O₃

Molecular weight: 142.1127

Ref: IN-DA001DF0

methyl 5-aminoisoxazole-4-carboxylate

CAS: 145798-74-9

Formula: C₅H₆N₂O₃

Purity: 95.0%

Color and Shape: Solid, White powder

Molecular weight: 142.114

Ref: 10-F308852

Methyl 5-aminoisoxazole-4-carboxylate

CAS: 145798-74-9

Versatile small molecule scaffold

Formula: C₅H₆N₂O₃

Purity: Min. 95%

Molecular weight: 142.11 g/mol

Ref: 3D-VFA79874