CAS 14581-81-8
:4-METHOXYPHENYL 2,3,4,6-TETRA-O-ACETYL-BETA-D-GLUCOPYANOSIDE
Description:
4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside is a glycoside compound characterized by its structural components, which include a methoxyphenyl group and a glucopyranoside moiety that is fully acetylated. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The acetylation of the hydroxyl groups on the glucopyranoside unit serves to protect these functional groups, making the compound more stable and less reactive under certain conditions. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex molecules. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used in experiments. Additionally, due to its glycosidic nature, it may exhibit specific interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry.
Formula:C21H26O11
InChI:InChI=1/C21H26O11/c1-11(22)27-10-17-18(28-12(2)23)19(29-13(3)24)20(30-14(4)25)21(32-17)31-16-8-6-15(26-5)7-9-16/h6-9,17-21H,10H2,1-5H3/t17-,18-,19+,20-,21-/m1/s1
Synonyms:- 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside
- beta-D-glucopyranoside, 4-methoxyphenyl, tetraacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Methoxyphenyl 2,3,4,6-Tetra-O-acetyl-β-D-glucopyanoside
CAS:Formula:C21H26O11Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:454.43β-D-Glucopyranoside, 4-methoxyphenyl, 2,3,4,6-tetraacetate
CAS:Formula:C21H26O11Purity:98%Color and Shape:SolidMolecular weight:454.42454-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside
CAS:4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranosidePurity:98%Molecular weight:454.42g/mol4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside
CAS:4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside is a membrane stabilizer that prevents the mesenchymal transition of cells. This compound inhibits the growth of human tumor cells in vitro and has been shown to be an anti-tumor agent. 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside binds to DNA and RNA and blocks translation or transcription. It also prevents the formation of ternary complex by interfering with the binding between aminoacyl tRNA synthetases and their cognate tRNAs. The compound is activated by intestinal enzymes and is metabolized in human liver microsomes to a more reactive form that can bind to cellular macromolecules such as proteins.Formula:C21H26O11Purity:Min. 95%Color and Shape:PowderMolecular weight:454.42 g/mol




