CAS 14581-81-8: 4-METHOXYPHENYL 2,3,4,6-TETRA-O-ACETYL-BETA-D-GLUCOPYANOSIDE
Description:4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside is a glycoside compound characterized by its structural components, which include a methoxyphenyl group and a glucopyranoside moiety that is fully acetylated. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The acetylation of the hydroxyl groups on the glucopyranoside unit serves to protect these functional groups, making the compound more stable and less reactive under certain conditions. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex molecules. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used in experiments. Additionally, due to its glycosidic nature, it may exhibit specific interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry.
Formula:C21H26O11
InChI:InChI=1/C21H26O11/c1-11(22)27-10-17-18(28-12(2)23)19(29-13(3)24)20(30-14(4)25)21(32-17)31-16-8-6-15(26-5)7-9-16/h6-9,17-21H,10H2,1-5H3/t17-,18-,19+,20-,21-/m1/s1
- Synonyms:
- 4-Methoxyphenyl 2,3,4,6-tetra-O-acetyl-beta-D-glucopyranoside
- beta-D-glucopyranoside, 4-methoxyphenyl, tetraacetate