CAS 14581-83-0
:Helicin, tetraacetate
Description:
Helicin, tetraacetate, with the CAS number 14581-83-0, is a chemical compound derived from helicin, a natural product found in certain plants. This compound is characterized by the presence of four acetate groups attached to the helicin structure, which significantly influences its solubility and reactivity. Typically, such acetylation enhances the compound's stability and alters its biological activity, making it of interest in various fields, including medicinal chemistry and biochemistry. The tetraacetate form may exhibit different physical properties compared to its parent compound, such as changes in melting point, boiling point, and spectral characteristics. Additionally, it may interact differently with biological systems, potentially affecting its pharmacological profile. The study of helicin derivatives like tetraacetate can provide insights into their potential applications, including their roles in plant defense mechanisms or their utility in synthetic organic chemistry. Overall, helicin, tetraacetate represents a fascinating area of study within the realm of natural product chemistry.
Formula:C21H24O11
InChI:InChI=1S/C21H24O11/c1-11(23)27-10-17-18(28-12(2)24)19(29-13(3)25)20(30-14(4)26)21(32-17)31-16-8-6-5-7-15(16)9-22/h5-9,17-21H,10H2,1-4H3/t17-,18-,19+,20-,21-/m1/s1
InChI key:InChIKey=PCBZIIGBXBDLBK-YMQHIKHWSA-N
SMILES:O(C(C)=O)[C@@H]1[C@@H](OC(C)=O)[C@H](OC2=C(C=O)C=CC=C2)O[C@H](COC(C)=O)[C@H]1OC(C)=O
Synonyms:- 2-Formylphenyl tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 2-Formylphenyl-2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside
- 2-[(2,3,4,6-Tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-glucopyranosyl)oxy]benzaldehyde
- Benzaldehyde, 2-[(2,3,4,6-tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-glucopyranosyl)oxy]-
- Helicin, tetraacetate
- o-Formylphenyl tetra-O-acetyl-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 2-[(2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl)oxy]benzaldehyde
- 2-Formylphenyl tetra-O-acetyl-β-D-glucopyranoside
- Benzaldehyde, 2-[(2,3,4,6-tetra-O-acetyl-β-D-glucopyranosyl)oxy]-
- o-Formylphenyl tetra-O-acetyl-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Formylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside
CAS:Formula:C21H24O11Molecular weight:452.40872-Formylphenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside
CAS:2-Formylphenyl 2,3,4,6-tetra-O-acetyl-β-D-glucopyranosideMolecular weight:452.40865g/mol2-Formylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside
CAS:2-Formylphenyl 2,3,4,6-tetra-O-acetyl-b-D-glucopyranoside is a natural product of the gentisyl family. It is synthesized from benzyl alcohol and acetic anhydride. This compound has been shown to have anticancer properties in animal studies. The acetyl groups are thought to be responsible for the cytotoxicity of this compound. Salireposide is one such analog that has been shown to inhibit protein synthesis and induce apoptosis in cancer cells.Formula:C21H24O11Purity:Min. 95%Color and Shape:PowderMolecular weight:452.41 g/mol



