
CAS 14585-66-1
:Benzo[b]thiophene-3-ethanamine
Description:
Benzo[b]thiophene-3-ethanamine is an organic compound characterized by its structure, which includes a benzo[b]thiophene moiety fused with an ethylamine group. This compound features a bicyclic aromatic system that incorporates a sulfur atom within the thiophene ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the amine functional group suggests that it can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Benzo[b]thiophene derivatives are of interest in various fields, including medicinal chemistry, due to their potential biological activities. The compound may also serve as a building block for synthesizing more complex molecules or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, Benzo[b]thiophene-3-ethanamine represents a versatile compound with potential applications in research and industry.
Formula:C10H11NS
InChI:InChI=1S/C10H11NS/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7H,5-6,11H2
InChI key:InChIKey=YWXDBWNXMZHMFX-UHFFFAOYSA-N
SMILES:C(CN)C=1C=2C(SC1)=CC=CC2
Synonyms:- 3-(2-Aminoethyl)benzothiophene
- 3-(2-Aminoethyl)benzo[b]thiophene
- Benzo[b]thiophene-3-ethanamine
- [2-(Benzo[b]thiophen-3-yl)ethyl]amine
- Benzo[b]thiophene-3-ethylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
