CAS 1458593-65-1
:Methyl 7-cyclopropylpyrazolo[1,5-a]pyrimidine-5-carboxylate
Description:
Methyl 7-cyclopropylpyrazolo[1,5-a]pyrimidine-5-carboxylate is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazolo and pyrimidine moiety. This compound features a cyclopropyl group, contributing to its potential biological activity and steric properties. It is typically classified as a heterocyclic organic compound, which may exhibit various pharmacological effects due to its structural characteristics. The presence of the carboxylate functional group suggests potential for reactivity and interaction with biological targets. Methyl esters, like this compound, are often used in medicinal chemistry for their ability to modulate solubility and bioavailability. The compound's specific properties, such as melting point, solubility, and reactivity, would depend on its molecular interactions and the environment in which it is studied. Research into such compounds often focuses on their potential applications in drug development, particularly in targeting specific enzymes or receptors in biological systems.
Formula:C11H11N3O2
InChI:InChI=1S/C11H11N3O2/c1-16-11(15)8-6-9(7-2-3-7)14-10(13-8)4-5-12-14/h4-7H,2-3H2,1H3
InChI key:InChIKey=OMPUBEBCAJROKN-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(N2C(N1)=CC=N2)C3CC3
Synonyms:- Methyl 7-cyclopropylpyrazolo[1,5-a]pyrimidine-5-carboxylate
- Pyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 7-cyclopropyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.