CAS 1459-20-7
:Desyl benzoate
Description:
Desyl benzoate, with the CAS number 1459-20-7, is an organic compound that belongs to the class of benzoates. It is characterized by its ester functional group, which is formed from the reaction of benzoic acid and desyl alcohol. This compound typically appears as a colorless to pale yellow liquid and is known for its pleasant, fruity odor. Desyl benzoate is often utilized in the fragrance industry due to its aromatic properties, making it a popular choice in perfumes and cosmetic formulations. Additionally, it may serve as a solvent or a plasticizer in various applications. The compound is generally considered to have low toxicity, but like many organic substances, it should be handled with care to avoid potential skin or respiratory irritation. Its stability under normal conditions makes it suitable for use in various formulations, although it should be stored away from strong oxidizing agents and extreme temperatures to maintain its integrity.
Formula:C21H16O3
InChI:InChI=1/C21H16O3/c22-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)24-21(23)18-14-8-3-9-15-18/h1-15,20H
SMILES:c1ccc(cc1)C(=O)C(c1ccccc1)OC(=O)c1ccccc1
Synonyms:- alpha-Benzoyloxy-alpha-phenylacetophenone
- 2-Oxo-1,2-Diphenylethyl Benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Desylbenzoate
CAS:Desylbenzoate is a hydroxy methyl ester that can be synthesized by reacting ethyl benzoate with methanol and sodium hydroxide. This reaction product can be used in the synthesis of polymers for magnetic resonance spectroscopy. Desylbenzoate has been shown to inhibit the growth of carcinoma cells and was found to have a molecular weight of 210. Desylbenzoate also reacts with nucleophiles such as hydroxide ion, giving the corresponding carbonyl group. The carbonyl group is then converted into an ester, which can react with other molecules, such as butanol, giving an ethyl ester.
Formula:C21H16O3Purity:Min. 95%Color and Shape:PowderMolecular weight:316.35 g/molRef: 3D-FD67668
Discontinued product


