CAS 1459-39-8
:cycloheptanecarboxamide
Description:
Cycloheptanecarboxamide, with the CAS number 1459-39-8, is an organic compound characterized by a cycloheptane ring substituted with a carboxamide functional group. This compound features a seven-membered carbon ring, which contributes to its unique structural properties. Cycloheptanecarboxamide is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is relatively soluble in organic solvents but has limited solubility in water due to its hydrophobic cycloheptane structure. The presence of the amide group imparts certain polar characteristics, allowing for potential hydrogen bonding interactions. Cycloheptanecarboxamide can be used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its stability and reactivity can be influenced by the conditions under which it is handled, including temperature and the presence of catalysts or other reagents. As with many organic compounds, proper safety measures should be observed when working with cycloheptanecarboxamide to mitigate any potential hazards.
Formula:C8H15NO
InChI:InChI=1/C8H15NO/c9-8(10)7-5-3-1-2-4-6-7/h7H,1-6H2,(H2,9,10)
SMILES:C1CCCC(CC1)C(=N)O
Synonyms:- Cycloheptanecarboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cycloheptanecarboxamide
CAS:Formula:C8H15NOPurity:99%;RGColor and Shape:SolidMolecular weight:141.214Cycloheptanecarboxamide
CAS:Cycloheptanecarboxamide is a cellular amide that is used in the study of β-amino acids. Cycloheptanecarboxamide is a prodrug that is converted to cycloheptylamine, which has been shown to be an inhibitor of proliferation and a potent inhibitor of inflammatory diseases. Cycloheptylamine also inhibits the production of aliphatic hydrocarbons and mineralocorticoids, as well as the activation of mineralocorticoid receptors. It has been shown to be an organic solution that can be used to generate tartrate-resistant acid potassium ions (TRAP).
Formula:C8H15NOPurity:Min. 95%Molecular weight:141.21 g/mol



