CAS 1459-49-0
:1-(4-Nitrophenyl)tricyclo[3.3.1.1<sup>3,7</sup>]decane
Description:
1-(4-Nitrophenyl)tricyclo[3.3.1.1^3,7]decane, with CAS number 1459-49-0, is an organic compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. The presence of a nitrophenyl group at the 1-position introduces both electron-withdrawing characteristics and potential sites for further chemical reactivity. This compound typically exhibits a solid state at room temperature and is likely to be insoluble or only sparingly soluble in water, while being more soluble in organic solvents due to its hydrophobic nature. The nitro group contributes to its polarity and can influence its reactivity, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the compound's structural complexity may impart interesting physical properties, such as melting and boiling points that differ significantly from simpler hydrocarbons. Its unique structure and functional group make it of interest in organic synthesis and materials science, particularly in the development of advanced materials or as intermediates in chemical reactions.
Formula:C16H19NO2
InChI:InChI=1S/C16H19NO2/c18-17(19)15-3-1-14(2-4-15)16-8-11-5-12(9-16)7-13(6-11)10-16/h1-4,11-13H,5-10H2
InChI key:InChIKey=KGJYJYQWAMPKER-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC=C(C23CC4CC(C2)CC(C3)C4)C=C1
Synonyms:- 1-(p-Nitrophenyl)adamantane
- Adamantane, 1-(p-nitrophenyl)-
- 1-(4-Nitrophenyl)adamantane
- Tricyclo[3.3.1.13,7]decane, 1-(4-nitrophenyl)-
- 1-(4-Nitrophenyl)tricyclo[3.3.1.13,7]decane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
