CAS 145915-58-8

4,5-Dianilinophthalimide

Description:

4,5-Dianilinophthalimide is an organic compound characterized by its structure, which includes two aniline groups attached to a phthalimide moiety. This compound typically exhibits properties such as high thermal stability and good solubility in organic solvents, making it suitable for various applications in materials science and organic electronics. It is often used as a dye or pigment due to its vibrant color and can also serve as a precursor in the synthesis of other chemical compounds. The presence of the aniline groups contributes to its potential as a semiconductor material, while the phthalimide structure enhances its stability and reactivity. Additionally, 4,5-Dianilinophthalimide may exhibit interesting photophysical properties, which can be exploited in optoelectronic devices. Safety data should be consulted, as with any chemical substance, to understand its handling and potential hazards. Overall, this compound represents a valuable material in the field of organic chemistry and related applications.

Formula: C₂₀H₁₅N₃O₂

InChI: InChI=1S/C20H15N3O2/c24-19-15-11-17(21-13-7-3-1-4-8-13)18(12-16(15)20(25)23-19)22-14-9-5-2-6-10-14/h1-12,21-22H,(H,23,24,25)

InChI key: InChIKey=AAALVYBICLMAMA-UHFFFAOYSA-N

SMILES: O=C1C=2C(=CC(NC3=CC=CC=C3)=C(NC4=CC=CC=C4)C2)C(=O)N1

Synonyms:

• DAPH
• 4,5-Dianilinophthalimide
• 1H-Isoindole-1,3(2H)-dione, 5,6-bis(phenylamino)-
• 5,6-Bis(phenylamino)-1H-isoindole-1,3(2H)-dione
• CGP 52411

1H-Isoindole-1,3(2H)-dione, 5,6-bis(phenylamino)-

CAS: 145915-58-8

Formula: C₂₀H₁₅N₃O₂

Purity: 99.71%

Color and Shape: Solid

Molecular weight: 329.3520

Ref: IN-DA001DII

CGP52411

CAS: 145915-58-8

CGP52411

Purity: ≥98%

Molecular weight: 329.35g/mol

Ref: 54-BUP15145

DAPH

CAS: 145915-58-8

Formula: C₂₀H₁₅N₃O₂

Molecular weight: 329.35

Ref: 7W-GK4459

CGP 52411

CAS: 145915-58-8

CGP 52411 is an experimental monoclonal antibody, which is a biologically derived product designed to interact with specific molecular targets in the body. It acts by binding to certain neuroreceptors or proteins, potentially modulating neurological pathways and processes. This mode of action makes it a prime candidate for exploring neuroprotection and therapeutic interventions in neurology research.

Formula: C₂₀H₁₅N₃O₂

Purity: Min. 95%

Molecular weight: 329.35 g/mol

Ref: 3D-VFA91558

CGP52411

CAS: 145915-58-8

CGP52411 is an orally active, and ATP-competitive inhibitor of EGFR (IC50: 0.3 μM).

Formula: C₂₀H₁₅N₃O₂

Purity: 99.78%

Color and Shape: Solid

Molecular weight: 329.35

Ref: TM-T10782