CAS 145915-60-2

5,6-BIS[(4-FLUOROPHENYL)AMINO]-1H-ISOINDOLE-1,3(2H)-DIONE

Description:

5,6-Bis[(4-fluorophenyl)amino]-1H-isoindole-1,3(2H)-dione, with the CAS number 145915-60-2, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoindole core substituted with two 4-fluorophenylamino groups. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of fluorine atoms in the phenyl groups can enhance the compound's lipophilicity and metabolic stability, which are important factors in pharmacological applications. Additionally, the isoindole moiety may contribute to its ability to interact with biological targets, potentially influencing its efficacy and safety profile. As with many synthetic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions and the presence of functional groups. Overall, this compound represents a class of molecules that may have significant implications in therapeutic research and development.

Formula: C₂₀H₁₃F₂N₃O₂

InChI: InChI=1/C20H13F2N3O2/c21-11-1-5-13(6-2-11)23-17-9-15-16(20(27)25-19(15)26)10-18(17)24-14-7-3-12(22)4-8-14/h1-10,23-24H,(H,25,26,27)

SMILES: c1cc(ccc1F)Nc1cc2c(cc1Nc1ccc(cc1)F)C(=O)N=C2O

Synonyms:

• Cgp 53353
• 5,6-Bis[(4-Fluorophenyl)Amino]-2H-Isoindole-1,3-Dione
• 5,6-Bis[(4-fluorophenyl)amino]-2H-isoindole-1,3-dione, DAPH 2

1H-ISOINDOLE-1,3(2H)-DIONE, 5,6-BIS[(4-FLUOROPHENYL)AMINO]-

CAS: 145915-60-2

Formula: C₂₀H₁₃F₂N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 365.3329

Ref: IN-DA001DIH

CGP 53353

CAS: 145915-60-2

CGP 53353

Purity: ≥98%

Molecular weight: 365.33g/mol

Ref: 54-BUP06346

CGP-53353

CAS: 145915-60-2

Formula: C₂₀H₁₃F₂N₃O₂

Purity: ≥ 98.0%

Color and Shape: Orange solid

Molecular weight: 365.33

Ref: 7W-GK5122

CGP 53353

CAS: 145915-60-2

CGP 53353 (DAPH-7) is a PKC inhibitor with inhibitory effects on PKCβII and PKCβI and can be used to study atherosclerosis.

Formula: C₂₀H₁₃F₂N₃O₂

Purity: 98.11%

Color and Shape: Solid

Molecular weight: 365.33

Ref: TM-T22650