CAS 145963-84-4
:N2,N2-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine
Description:
N2,N2-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine is a chemical compound characterized by its triazine core, which is a six-membered aromatic ring containing three nitrogen atoms. This compound features two dimethylamino groups at the 2 and 4 positions, enhancing its basicity and potential reactivity. The presence of a 2,2,2-trifluoroethoxy substituent at the 6 position contributes to its unique properties, including increased lipophilicity and potential applications in agrochemicals or pharmaceuticals. The trifluoroethyl group can also influence the compound's solubility and stability in various solvents. As a triazine derivative, it may exhibit herbicidal or fungicidal activity, making it of interest in agricultural chemistry. Additionally, the compound's structure suggests potential for hydrogen bonding and interactions with biological targets, which could be relevant in medicinal chemistry. Overall, N2,N2-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine is a versatile compound with properties that warrant further investigation for various applications.
Formula:C7H10F3N5O
InChI:InChI=1S/C7H10F3N5O/c1-15(2)5-12-4(11)13-6(14-5)16-3-7(8,9)10/h3H2,1-2H3,(H2,11,12,13,14)
InChI key:InChIKey=CDIMJMNYIJEGBW-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C=1N=C(N(C)C)N=C(N)N1
Synonyms:- 1,3,5-Triazine-2,4-diamine, N,N-dimethyl-6-(2,2,2-trifluoroethoxy)-
- 1,3,5-Triazine-2,4-diamine, N<sup>2</sup>,N<sup>2</sup>-dimethyl-6-(2,2,2-trifluoroethoxy)-
- 1,3,5-triazine-2,4-diamine, N2
- 2-Amino-4-dimethylamino-6-trifluoroethoxy sym-triazine
- 2-N,2-N-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine
- N2,N2-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine
- N<sup>2</sup>,N<sup>2</sup>-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine
- 1,3,5-Triazine-2,4-diamine, N2,N2-dimethyl-6-(2,2,2-trifluoroethoxy)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N2,N2-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine
CAS:Formula:C7H10F3N5OMolecular weight:237.1824N2,N2-Dimethyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine
CAS:Controlled ProductFormula:C7H10F3N5OColor and Shape:NeatMolecular weight:237.182

