CAS 14597-58-1

5-Amino-thiophene-2-carboxylic acid methyl ester

Description:

5-Amino-thiophene-2-carboxylic acid methyl ester is an organic compound characterized by the presence of both an amino group and a carboxylic acid ester functional group, which contributes to its reactivity and potential applications in organic synthesis. The thiophene ring structure imparts aromatic properties, enhancing its stability and influencing its electronic characteristics. This compound typically appears as a solid or crystalline substance and is soluble in polar organic solvents, making it suitable for various chemical reactions. Its amino group can participate in nucleophilic substitution reactions, while the ester functionality can undergo hydrolysis or transesterification. The compound is of interest in medicinal chemistry and materials science, as derivatives of thiophene are often explored for their biological activities and as building blocks in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₆H₇NO₂S

InChI: InChI=1/C6H7NO2S/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,7H2,1H3

SMILES: COC(=O)c1ccc(N)s1

Synonyms:

• 5-Aminothiophene-2-Carboxylic Methyl Ester
• Methyl 5-Aminothiophene-2-Carboxylate

2-Thiophenecarboxylic acid, 5-amino-, methyl ester

CAS: 14597-58-1

Formula: C₆H₇NO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 157.1903

Ref: IN-DA001DKU

Methyl 5-aminothiophene-2-carboxylate

CAS: 14597-58-1

Methyl 5-aminothiophene-2-carboxylate

Purity: 97%

Molecular weight: 157.19g/mol

Ref: 54-OR74894

Methyl 5-aminothiophene-2-carboxylate

CAS: 14597-58-1

Formula: C₆H₇NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 157.19

Ref: 10-F209217