CAS 1459748-95-8

5-Methoxy-2-pyrimidinemethanol

Description:

5-Methoxy-2-pyrimidinemethanol is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a methoxy group (-OCH3) at the 5-position enhances its solubility in organic solvents and may influence its reactivity and biological activity. The hydroxymethyl group (-CH2OH) at the 2-position contributes to its potential as a building block in organic synthesis and medicinal chemistry. This compound may exhibit various properties, including potential antimicrobial or antiviral activities, owing to its structural features. Its molecular interactions can be influenced by the presence of functional groups, making it a candidate for further research in drug development. As with many organic compounds, its stability, reactivity, and biological effects can vary based on environmental conditions and the presence of other substances. Proper handling and storage are essential to maintain its integrity and prevent degradation.

Formula: C₆H₈N₂O₂

InChI: InChI=1S/C6H8N2O2/c1-10-5-2-7-6(4-9)8-3-5/h2-3,9H,4H2,1H3

InChI key: InChIKey=WCRPQDPGKHYFSH-UHFFFAOYSA-N

SMILES: O(C)C=1C=NC(CO)=NC1

2-Pyrimidinemethanol, 5-methoxy-

CAS: 1459748-95-8

Formula: C₆H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 140.1399

Ref: IN-DA001DKF

2-(Hydroxymethyl)-5-methoxypyrimidine

CAS: 1459748-95-8

2-(Hydroxymethyl)-5-methoxypyrimidine

Purity: ≥95%

Molecular weight: 140.14g/mol

Ref: 54-OR471459

(5-METHOXYPYRIMIDIN-2-YL)METHANOL

CAS: 1459748-95-8

Formula: C₆H₈N₂O₂

Purity: >97%

Molecular weight: 140.142

Ref: 10-F500711

2-(Hydroxymethyl)-5-methoxypyrimidine

CAS: 1459748-95-8

Versatile small molecule scaffold

Formula: C₆H₈N₂O₂

Purity: Min. 95%

Molecular weight: 140.14 g/mol

Ref: 3D-JIC74895