CAS 145980-90-1

3-Chloro-2,6-dimethoxybenzenesulfonyl chloride

Description:

3-Chloro-2,6-dimethoxybenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides and other derivatives. This compound features a chlorinated aromatic ring with two methoxy groups positioned at the 2 and 6 positions, contributing to its electronic properties and steric hindrance. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions. It is typically used in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl-containing compounds. The compound is likely to be a solid at room temperature and may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during use. Additionally, it is important to consider its stability under various conditions, as sulfonyl chlorides can hydrolyze in the presence of moisture, releasing hydrochloric acid and forming the corresponding sulfonic acid.

Formula: C₈H₈Cl₂O₄S

InChI: InChI=1S/C8H8Cl2O4S/c1-13-6-4-3-5(9)7(14-2)8(6)15(10,11)12/h3-4H,1-2H3

InChI key: InChIKey=JOJNRDCALXLXJY-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C1=C(OC)C(Cl)=CC=C1OC

Synonyms:

• 3-Chloro-2,6-dimethoxybenzenesulfonyl chloride
• Benzenesulfonyl chloride, 3-chloro-2,6-dimethoxy-
• 3-Chloro-2,6-dimethoxybenzene-1-sulfonyl chloride

3-Chloro-2,6-dimethoxybenzene-1-sulfonyl chloride

CAS: 145980-90-1

Versatile small molecule scaffold

Formula: C₈H₈Cl₂O₄S

Purity: Min. 95%

Molecular weight: 271.12 g/mol

Ref: 3D-VFA98090