CAS 145986-07-8: 1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidine-2,4(1H,3H)-dione
Description:1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidine-2,4(1H,3H)-dione, with CAS number 145986-07-8, is a chemical compound characterized by its unique structural features that include a pyrimidine ring and an oxathiolane moiety. The presence of the hydroxymethyl group contributes to its potential reactivity and solubility in polar solvents. This compound is of interest in medicinal chemistry, particularly for its potential biological activities, which may include antiviral or antitumor properties. The stereochemistry indicated by the (2R,5S) configuration suggests specific spatial arrangements that can influence the compound's interactions with biological targets. Additionally, the dione functional groups imply the presence of two carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. Overall, this compound's structural complexity and functional groups make it a subject of interest for further research in drug development and synthetic chemistry.
Formula:C8H10N2O4S
InChI:InChI=1/C8H10N2O4S/c11-3-7-14-6(4-15-7)10-2-1-5(12)9-8(10)13/h1-2,6-7,11H,3-4H2,(H,9,12,13)/t6-,7+/m0/s1