CAS 145987-00-4

(R)-(+)-2-(Phenylcarbamoyloxy)propionic acid

Description:

(R)-(+)-2-(Phenylcarbamoyloxy)propionic acid, also known as a chiral derivative of propionic acid, is characterized by its specific stereochemistry, which contributes to its biological activity. This compound features a propionic acid backbone with a phenylcarbamoyloxy group, enhancing its solubility and potential interactions with biological targets. It is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. The presence of the phenylcarbamoyloxy moiety suggests potential applications in pharmaceuticals, particularly as a non-steroidal anti-inflammatory drug (NSAID) or in related therapeutic areas. The chirality of the molecule is significant, as it can influence the pharmacokinetics and pharmacodynamics, leading to different biological effects compared to its enantiomers. Additionally, the compound may exhibit specific melting and boiling points, as well as distinct spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization in laboratory settings.

Formula: C₁₀H₁₁NO₄

InChI: InChI=1/C10H11NO4/c1-7(9(12)13)15-10(14)11-8-5-3-2-4-6-8/h2-7H,1H3,(H,11,14)(H,12,13)/t7-/m1/s1

SMILES: C[C@H](C(=O)O)OC(=Nc1ccccc1)O

Synonyms:

• (R)-(+)-Browns
• (2R)-2-[(phenylcarbamoyl)oxy]propanoic acid
• (R)-(+)-2-(Phenylcarbamoyloxy)Propionic Acid

Propanoic acid, 2-[[(phenylamino)carbonyl]oxy]-, (2R)-

CAS: 145987-00-4

Formula: C₁₀H₁₁NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 209.1986

Ref: IN-DA001DL4

(R)-2-((PHENYLCARBAMOYL)OXY)PROPANOIC ACID

CAS: 145987-00-4

Formula: C₁₀H₁₁NO₄

Purity: 95.0%

Molecular weight: 209.201

Ref: 10-F530181