CAS 146-80-5: Xanthosine
Description:Xanthosine is a purine nucleoside that consists of the nitrogenous base xanthine linked to a ribose sugar. It is a naturally occurring compound found in various biological systems and plays a role in nucleotide metabolism. Xanthosine is involved in the synthesis and degradation of nucleotides, contributing to cellular energy transfer and signaling processes. The chemical formula of xanthosine is C10H12N4O5, and it has a molecular weight that reflects its composition of carbon, hydrogen, nitrogen, and oxygen atoms. In terms of solubility, xanthosine is generally soluble in water, which facilitates its biological functions. It can be phosphorylated to form xanthosine monophosphate (XMP), an important intermediate in the purine nucleotide synthesis pathway. Additionally, xanthosine has been studied for its potential roles in various physiological processes, including its effects on cellular signaling and its implications in certain diseases. Its CAS number, 146-80-5, is a unique identifier used to facilitate the identification and regulation of this compound in scientific literature and databases.
Formula:C10H12N4O6
InChI:InChI=1S/C10H12N4O6/c15-1-3-5(16)6(17)9(20-3)14-2-11-4-7(14)12-10(19)13-8(4)18/h2-3,5-6,9,15-17H,1H2,(H2,12,13,18,19)/t3-,5-,6-,9-/m1/s1
InChI key:InChIKey=UBORTCNDUKBEOP-UUOKFMHZSA-N
SMILES:O=C1NC(=O)C=2N=CN(C2N1)C3OC(CO)C(O)C3O
- Synonyms:
- (S)-1-(Azetidin-3-yl)pyrrolidin-3-ol hydrochloride
- 1H-Purine-2,6-dione, 3,9-dihydro-9-β-<span class="text-smallcaps">D</span>-ribofuranosyl-
- 2,3-Dihydro-2-oxoinosine
- 3,9-Dihydro-9-β-<span class="text-smallcaps">D</span>-ribofuranosyl-1H-purine-2,6-dione
- 9-pentofuranosyl-3,9-dihydro-1H-purine-2,6-dione
- 9-β-<span class="text-smallcaps">D</span>-Ribofuranosylxanthine
- Inosine, 2,3-dihydro-2-oxo-
- NSC 18930
- β-<span class="text-smallcaps">D</span>-Ribofuranoside, xanthine-9
- 3,9-Dihydro-9-β-D-ribofuranosyl-1H-purine-2,6-dione
- See more synonyms
- Xanthosine
- 9-β-D-Ribofuranosylxanthine
- 1H-Purine-2,6-dione, 3,9-dihydro-9-β-D-ribofuranosyl-
- β-D-Ribofuranoside, xanthine-9
