CAS 1460-05-5
:(4-NITRO-PHENYL)-ACETALDEHYDE
Description:
(4-Nitro-phenyl)-acetaldehyde, with the CAS number 1460-05-5, is an organic compound characterized by the presence of a nitro group and an aldehyde functional group. It features a phenyl ring substituted at the para position with a nitro group, which contributes to its reactivity and potential applications in organic synthesis. The aldehyde group is known for its reactivity in nucleophilic addition reactions, making this compound useful in various chemical transformations. Typically, compounds like (4-nitro-phenyl)-acetaldehyde exhibit moderate to high polarity due to the electronegative nitro group, which can influence solubility in polar solvents. Additionally, the presence of the nitro group can enhance the compound's electrophilic character, making it a potential candidate for further derivatization in synthetic chemistry. Safety considerations should be taken into account, as nitro compounds can be hazardous and may require careful handling and storage. Overall, (4-nitro-phenyl)-acetaldehyde serves as a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C8H7NO3
InChI:InChI=1/C8H7NO3/c10-6-5-7-1-3-8(4-2-7)9(11)12/h1-4,6H,5H2
SMILES:c1cc(ccc1CC=O)N(=O)=O
Synonyms:- 2-(4-Nitrophenyl)Acetaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(4-Nitrophenyl)acetaldehyde
CAS:<p>2-(4-Nitrophenyl)acetaldehyde</p>Purity:95%Molecular weight:165.15g/mol(4-Nitrophenyl)acetaldehyde
CAS:<p>4-Nitrophenylacetaldehyde is an organic compound that belongs to the group of reactive chemicals. It is synthetically derived from nitrobenzene and reacts with proton, covalent adducts, or other functional groups. 4-Nitrophenylacetaldehyde has been shown to be a target for cancer research because it can be used to produce cancer drugs by linking a variety of functional groups to the molecule. The nitrogen atom in the molecule is also a target for research because it can be converted into nitro groups and can help in the development of new drugs through dehydration reactions.</p>Formula:C8H7NO3Purity:Min. 95%Molecular weight:165.15 g/mol




