CAS 1460-18-0
:Pentadecanedioic acid
Description:
Pentadecanedioic acid, also known as 1,15-pentadecanedioic acid, is a dicarboxylic acid characterized by a long carbon chain consisting of 15 carbon atoms with carboxylic acid functional groups at both ends. Its molecular formula is C15H28O4, and it features two -COOH groups, which contribute to its acidic properties. This compound is typically a white, crystalline solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic carbon chain. Pentadecanedioic acid is used in various applications, including the synthesis of polyesters, surfactants, and as a building block in organic synthesis. Its long-chain structure imparts unique properties, making it useful in the production of specialty chemicals and materials. Additionally, it can be derived from natural sources, such as certain plant oils, and is of interest in the field of biochemistry and materials science for its potential applications in biodegradable polymers and other environmentally friendly materials.
Formula:C15H28O4
InChI:InChI=1S/C15H28O4/c16-14(17)12-10-8-6-4-2-1-3-5-7-9-11-13-15(18)19/h1-13H2,(H,16,17)(H,18,19)
InChI key:InChIKey=BTZVDPWKGXMQFW-UHFFFAOYSA-N
SMILES:C(CC(O)=O)CCCCCCCCCCCC(O)=O
Synonyms:- 1,13-Tridecamethylenedicarboxylic acid
- 1,13-Tridecanedicarboxylic acid
- Pentadecanedioic acid
- ω-Carboxymyristic acid
- 1,15-Pentadecanedioic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Pentadecanedioic Acid
CAS:Formula:C15H28O4Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:272.39Pentadecanedioic acid
CAS:<p>Pentadecanedioic acid is a fatty acid that is often used as a pharmaceutical preparation. It has been shown to have inhibitory effects for the removal of malonic acid and other organic acids from wastewater treatment by biological treatment. Pentadecanedioic acid can be synthesized from trifluoroacetic acid and cyclohexane ring, which are precursors to this compound. The hydroxyl group on pentadecanedioic acid makes it susceptible to fluorescence spectrometry, making it an appropriate sample preparation method for this compound.</p>Formula:C15H28O4Purity:Min. 95%Color and Shape:PowderMolecular weight:272.38 g/mol
