CAS 14602-39-2
:cis-5,8,11-eicosatrienoic acid methyl*ester
Description:
Cis-5,8,11-eicosatrienoic acid methyl ester, also known as methyl cis-5,8,11-eicosatrienoate, is a methyl ester derived from eicosatrienoic acid, a polyunsaturated fatty acid. This compound features a long carbon chain with a total of 20 carbon atoms and three cis double bonds located at the 5th, 8th, and 11th positions. The presence of these double bonds contributes to its unsaturated nature, influencing its physical properties such as lower melting points compared to saturated fatty acids. As a methyl ester, it is typically more soluble in organic solvents and exhibits characteristics common to fatty acid esters, including potential applications in biodiesel production and as a precursor in the synthesis of various bioactive compounds. The compound is of interest in nutritional and biochemical studies due to its potential health benefits, including anti-inflammatory properties. Its CAS number, 14602-39-2, uniquely identifies it in chemical databases, facilitating research and regulatory compliance.
Formula:C21H36O2
InChI:InChI=1/C21H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h10-11,13-14,16-17H,3-9,12,15,18-20H2,1-2H3/b11-10-,14-13-,17-16-
SMILES:CCCCCCCC/C=C\C/C=C\C/C=C\CCCC(=O)OC
Synonyms:- methyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5(Z),8(Z),11(Z)-Eicosatrienoic Acid methyl ester
CAS:Formula:C21H36O2Color and Shape:LiquidMolecular weight:320.5093Methyl 5(Z),8(Z),11(Z)-Eicosatrienoate
CAS:Formula:C21H36O2Purity:>98%Color and Shape:In solution, MethanolMolecular weight:320.515(Z),8(Z),11(Z)-Eicosatrienoic Acid methyl ester
CAS:Mead acid, a 20-carbon ω-9 polyunsaturated fatty acid, experiences elevated levels in human plasma under conditions of essential fatty acid deficiency. As 1,25(Z),8(Z),11(Z)-Eicosatrienoic Acid methyl ester (Mead acid methyl ester), it frequently serves as a standard for fatty acid analysis, particularly after fatty acids have been transesterified into methyl esters.Formula:C21H36O2Color and Shape:SolidMolecular weight:320.517



