CAS 14603-76-0
:(R)-(-)-2-AMINO-2-METHYLBUTANEDIOIC ACID
Description:
(R)-(-)-2-Amino-2-methylbutanedioic acid, commonly known as L-threonine, is an α-amino acid that plays a crucial role in protein synthesis. It is characterized by its chiral center, which gives rise to its specific stereochemistry, denoted by the (R) configuration. This compound is a colorless, crystalline solid that is soluble in water, reflecting its polar nature due to the presence of both amino and carboxylic acid functional groups. L-threonine is essential for human nutrition, meaning it must be obtained through dietary sources, as the body cannot synthesize it. It is involved in various metabolic processes, including the synthesis of proteins, and serves as a precursor for other important biomolecules. Additionally, it has applications in the food and pharmaceutical industries, particularly in formulations aimed at enhancing nutritional profiles. The compound's CAS number, 14603-76-0, is a unique identifier that facilitates its identification in chemical databases and regulatory documents.
Formula:C5H9NO4
InChI:InChI=1/C5H9NO4/c1-5(6,4(9)10)2-3(7)8/h2,6H2,1H3,(H,7,8)(H,9,10)/t5-/m1/s1
SMILES:C[C@@](CC(=O)O)(C(=O)O)N
Synonyms:- (R)-2-Amino-2-Methylpropanedioic Acid
- (-)-2-Methyl-D-Aspartic Acid
- Alpha-Methyl-D-Asp
- (R)-(-)-2-Amino-2-methylbutanedioicacid,80%ee
- (R)-a-Methyl-aspartic acid (>98%, >99%ee)
- H-alpha-Me-D-Asp-OH
- (2R)-2-ammonio-2-methylbutanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-2-Amino-2-methylsuccinic Acid
CAS:Controlled ProductFormula:C5H9NO4Color and Shape:NeatMolecular weight:147.1
