
CAS 146033-03-6
:8-Chlorodibenz[b,f][1,4]oxazepine-10(11H)-carboxylic acid 2-[1-oxo-3-(4-pyridinyl)propyl]hydrazide
Description:
8-Chlorodibenz[b,f][1,4]oxazepine-10(11H)-carboxylic acid 2-[1-oxo-3-(4-pyridinyl)propyl]hydrazide, with CAS number 146033-03-6, is a chemical compound characterized by its complex structure, which includes a dibenzoxazepine core, a carboxylic acid functional group, and a hydrazide moiety. This compound features a chlorine substituent on the dibenzoxazepine ring, which can influence its reactivity and biological activity. The presence of the pyridine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The hydrazide functional group may contribute to its ability to form hydrogen bonds, enhancing solubility and reactivity. Overall, this compound's unique structural features may impart specific pharmacological properties, making it a candidate for further investigation in drug development or as a research tool in various chemical applications. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its behavior in biological systems would require thorough evaluation through pharmacological studies.
Formula:C22H19ClN4O3
InChI:InChI=1S/C22H19ClN4O3/c23-17-6-7-20-18(13-17)27(14-16-3-1-2-4-19(16)30-20)22(29)26-25-21(28)8-5-15-9-11-24-12-10-15/h1-4,6-7,9-13H,5,8,14H2,(H,25,28)(H,26,29)
InChI key:InChIKey=XDJPQOUDGROSEU-UHFFFAOYSA-N
SMILES:C(NNC(CCC=1C=CN=CC1)=O)(=O)N2C=3C(OC=4C(C2)=CC=CC4)=CC=C(Cl)C3
Synonyms:- Dibenz[b,f][1,4]oxazepine-10(11H)-carboxylic acid, 8-chloro-, 2-[1-oxo-3-(4-pyridinyl)propyl]hydrazide
- 8-Chlorodibenz[b,f][1,4]oxazepine-10(11H)-carboxylic acid 2-[1-oxo-3-(4-pyridinyl)propyl]hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
SC 51089 free base
CAS:<p>SC 51089 free base is a selective antagonist of the prostaglandin E2 EP1 receptor, demonstrating neuroprotective activity.</p>Formula:C22H19ClN4O3Color and Shape:SolidMolecular weight:422.86
