CymitQuimica logo

CAS 146038-53-1

:

3-fluorobicyclo[1.1.1]pentane-1-carboxylic acid

Description:
3-Fluorobicyclo[1.1.1]pentane-1-carboxylic acid is a bicyclic compound characterized by its unique bicyclo[1.1.1]pentane framework, which consists of a three-membered carbon ring fused to a five-membered carbon ring. The presence of a carboxylic acid functional group (-COOH) at the 1-position contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The fluorine substituent at the 3-position introduces electronegativity, which can influence the compound's reactivity and polarity. This compound is of interest in medicinal chemistry and materials science due to its structural features, which may impart unique properties such as increased stability or altered biological activity. Its synthesis typically involves multi-step organic reactions, and it may be utilized in the development of pharmaceuticals or as a building block in organic synthesis. Overall, 3-fluorobicyclo[1.1.1]pentane-1-carboxylic acid exemplifies the intriguing chemistry associated with bicyclic compounds and their derivatives.
Formula:C6H7FO2
InChI:InChI=1S/C6H7FO2/c7-6-1-5(2-6,3-6)4(8)9/h1-3H2,(H,8,9)
InChI key:CQOUAQUBJPKQON-UHFFFAOYSA-N
SMILES:C1C2(CC1(C2)F)C(=O)O
Found 6 products.