CAS 146088-00-8: Benzene, (methylsilyl)-, homopolymer
Description:Benzene, (methylsilyl)-, homopolymer, identified by CAS number 146088-00-8, is a synthetic polymer characterized by its structure, which includes benzene rings and methylsilyl groups. This polymer exhibits properties typical of both aromatic compounds and siloxanes, contributing to its unique characteristics. It is generally known for its thermal stability, chemical resistance, and flexibility, making it suitable for various applications in coatings, adhesives, and sealants. The presence of the methylsilyl groups enhances its hydrophobicity and improves its compatibility with other materials, which can be advantageous in formulations requiring moisture resistance. Additionally, the polymer's mechanical properties can be tailored through modifications in its molecular weight and cross-linking density. Overall, this substance is valued in industrial applications for its durability and performance under diverse environmental conditions. However, specific handling and safety guidelines should be followed due to the potential hazards associated with its components.
Formula:(C7H10Si)x
InChI:InChI=1S/C7H10Si/c1-8-7-5-3-2-4-6-7/h2-6H,8H2,1H3
InChI key:InChIKey=QRLBICHXRCOJDU-UHFFFAOYSA-N
SMILES:C=1C=CC(=CC1)[SiH2]C
- Synonyms:
- Benzene, (methylsilyl)-, homopolymer
- Poly(methylphenylsilane)
- Methylphenylsilane homopolymer
- Silane, methylphenyl-, homopolymer
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzene, (methylsilyl)-, homopolymer REF: IN-DA001DNPCAS: 146088-00-8 | - - - | To inquire | Tue 06 May 25 |