CAS 14609-54-2: meso-Tetra(4-carboxyphenyl)porphine
Description:meso-Tetra(4-carboxyphenyl)porphine, with the CAS number 14609-54-2, is a synthetic porphyrin compound characterized by its four carboxyphenyl substituents attached to the meso positions of the porphyrin ring. This structure imparts significant solubility in polar solvents, making it useful in various applications, including photodynamic therapy and as a dye in biological systems. The carboxylic acid groups enhance its ability to form complexes with metal ions, which can be utilized in catalysis and sensing applications. The compound exhibits strong absorption in the visible region of the electromagnetic spectrum, particularly in the Soret and Q bands, which is typical for porphyrins, allowing it to participate in light-harvesting processes. Additionally, meso-Tetra(4-carboxyphenyl)porphine can undergo various chemical modifications, enabling the development of functionalized derivatives for specific applications in materials science and biochemistry. Its unique properties make it a subject of interest in research related to photochemistry and molecular electronics.
Formula:C48H30N4O8
InChI:InChI=1/C48H30N4O8/c53-45(54)29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(12-4-26)46(55)56)37-21-23-39(51-37)44(28-7-15-32(16-8-28)48(59)60)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(14-6-27)47(57)58/h1-24,49,52H,(H,53,54)(H,55,56)(H,57,58)(H,59,60)/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-
- Synonyms:
- 4,4,4,4-(Porphine-5,10,15,20-tetrayl)tetrakis(benzoic acid)
- 4,4',4'',4'''-Porphyrin-5,10,15,20-Tetrayltetrabenzoic Acid