CAS 1461-03-6
:(+)-β-Himachalene
Description:
(+)-β-Himachalene is a naturally occurring sesquiterpene hydrocarbon, primarily found in various plant species, particularly in the essential oils of certain conifers. It is characterized by its complex bicyclic structure, which contributes to its unique physical and chemical properties. This compound is typically a colorless to pale yellow liquid with a distinct aroma, often described as woody or earthy. (+)-β-Himachalene is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in both pharmacological and cosmetic applications. Its molecular formula reflects a relatively high degree of unsaturation, which is common among terpenes, and it exhibits a specific optical rotation, indicating its chiral nature. The compound is soluble in organic solvents but has limited solubility in water, typical of many hydrophobic organic compounds. Due to its natural origin and potential therapeutic benefits, (+)-β-Himachalene is studied for its applications in natural product chemistry and the fragrance industry.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h10,14H,5-9H2,1-4H3/t14-/m0/s1
InChI key:InChIKey=LCOSCMLXPAQCLQ-AWEZNQCLSA-N
SMILES:CC1(C)[C@@]2(C(=C(C)CCC1)CCC(C)=C2)[H]
Synonyms:- (4aR)-2,4a,5,6,7,8-Hexahydro-3,5,5,9-tetramethyl-1H-benzocycloheptene
- 1H-Benzocycloheptene, 2,4a,5,6,7,8-hexahydro-3,5,5,9-tetramethyl-, (R)-
- 1H-Benzocycloheptene, 2,4aβ,5,6,7,8-hexahydro-3,5,5,9-tetramethyl-, (+)-
- β-Himachalene
- 1H-Benzocycloheptene, 2,4a,5,6,7,8-hexahydro-3,5,5,9-tetramethyl-, (4aR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
